C20H23NO6 — CID 108753995
3-[(4-butoxy-3-ethoxybenzoyl)amino]-4-hydroxybenzoic acid (PubChem CID 108753995) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-[(4-butoxy-3-ethoxybenzoyl)amino]-4-hydroxybenzoic acid.
| Compound Name | 3-[(4-butoxy-3-ethoxybenzoyl)amino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108753995 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-[(4-butoxy-3-ethoxybenzoyl)amino]-4-hydroxybenzoic acid |
| SMILES | CCCCOc1ccc(C(=O)Nc2cc(C(=O)O)ccc2O)cc1OCC |
| InChI | InChI=1S/C20H23NO6/c1-3-5-10-27-17-9-7-13(12-18(17)26-4-2)19(23)21-15-11-14(20(24)25)6-8-16(15)22/h6-9,11-12,22H,3-5,10H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | AEKREJPMUWAVSU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|