C18H21NO4 — CID 26864885
3,4-diethoxy-N-(2-hydroxy-4-methylphenyl)benzamide (PubChem CID 26864885) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3,4-diethoxy-N-(2-hydroxy-4-methylphenyl)benzamide.
| Compound Name | 3,4-diethoxy-N-(2-hydroxy-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 26864885 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3,4-diethoxy-N-(2-hydroxy-4-methylphenyl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(C)cc2O)cc1OCC |
| InChI | InChI=1S/C18H21NO4/c1-4-22-16-9-7-13(11-17(16)23-5-2)18(21)19-14-8-6-12(3)10-15(14)20/h6-11,20H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | AFCCEUJJGBSFFV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|