C20H24N2O5 — CID 17457142
3,4-diethoxy-N-[2-(2-hydroxy-4-methylanilino)-2-oxoethyl]benzamide (PubChem CID 17457142) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(2-hydroxy-4-methylanilino)-2-oxoethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-(2-hydroxy-4-methylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17457142 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 3,4-diethoxy-N-[2-(2-hydroxy-4-methylanilino)-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2ccc(C)cc2O)cc1OCC |
| InChI | InChI=1S/C20H24N2O5/c1-4-26-17-9-7-14(11-18(17)27-5-2)20(25)21-12-19(24)22-15-8-6-13(3)10-16(15)23/h6-11,23H,4-5,12H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | INEJLRXUOOPZMK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|