C17H26N2O4 — CID 34837733
N-[2-(diethylamino)-2-oxoethyl]-3,4-diethoxybenzamide (PubChem CID 34837733) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-oxoethyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-(diethylamino)-2-oxoethyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 34837733 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[2-(diethylamino)-2-oxoethyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)N(CC)CC)cc1OCC |
| InChI | InChI=1S/C17H26N2O4/c1-5-19(6-2)16(20)12-18-17(21)13-9-10-14(22-7-3)15(11-13)23-8-4/h9-11H,5-8,12H2,1-4H3,(H,18,21) |
| InChIKey | FPTGQDFQLQQWIN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |