C22H27N3O5 — CID 38105972
N-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-3,4-diethoxybenzamide (PubChem CID 38105972) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 38105972 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2ccc(C(=O)N(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C22H27N3O5/c1-5-29-18-12-9-16(13-19(18)30-6-2)21(27)23-14-20(26)24-17-10-7-15(8-11-17)22(28)25(3)4/h7-13H,5-6,14H2,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | SJTMVYHIVBXWKA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |