C26H34N4O5 — CID 154860239
3,4-diethoxy-N-[2-[4-(4-ethylpiperazine-1-carbonyl)anilino]-2-oxoethyl]benzamide (PubChem CID 154860239) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-[4-(4-ethylpiperazine-1-carbonyl)anilino]-2-oxoethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-[4-(4-ethylpiperazine-1-carbonyl)anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 154860239 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 3,4-diethoxy-N-[2-[4-(4-ethylpiperazine-1-carbonyl)anilino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2ccc(C(=O)N3CCN(CC)CC3)cc2)cc1OCC |
| InChI | InChI=1S/C26H34N4O5/c1-4-29-13-15-30(16-14-29)26(33)19-7-10-21(11-8-19)28-24(31)18-27-25(32)20-9-12-22(34-5-2)23(17-20)35-6-3/h7-12,17H,4-6,13-16,18H2,1-3H3,(H,27,32)(H,28,31) |
| InChIKey | UWPPUTDCKBPVDF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |