C26H26FN3O5 — CID 55946843
3,4-diethoxy-N-[2-[3-[(3-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]benzamide (PubChem CID 55946843) has the molecular formula C26H26FN3O5 and a molecular weight of 479.51 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-[3-[(3-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-[3-[(3-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55946843 |
| Molecular Formula | C26H26FN3O5 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 3,4-diethoxy-N-[2-[3-[(3-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2cccc(C(=O)Nc3cccc(F)c3)c2)cc1OCC |
| InChI | InChI=1S/C26H26FN3O5/c1-3-34-22-12-11-18(14-23(22)35-4-2)25(32)28-16-24(31)29-20-9-5-7-17(13-20)26(33)30-21-10-6-8-19(27)15-21/h5-15H,3-4,16H2,1-2H3,(H,28,32)(H,29,31)(H,30,33) |
| InChIKey | QWVWQCHEPACBIZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |