C20H22F2N2O5 — CID 55847529
N-[2-[3-(difluoromethoxy)anilino]-2-oxoethyl]-3,4-diethoxybenzamide (PubChem CID 55847529) has the molecular formula C20H22F2N2O5 and a molecular weight of 408.40 g/mol. Its IUPAC name is N-[2-[3-(difluoromethoxy)anilino]-2-oxoethyl]-3,4-diethoxybenzamide.
| Compound Name | N-[2-[3-(difluoromethoxy)anilino]-2-oxoethyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 55847529 |
| Molecular Formula | C20H22F2N2O5 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[2-[3-(difluoromethoxy)anilino]-2-oxoethyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2cccc(OC(F)F)c2)cc1OCC |
| InChI | InChI=1S/C20H22F2N2O5/c1-3-27-16-9-8-13(10-17(16)28-4-2)19(26)23-12-18(25)24-14-6-5-7-15(11-14)29-20(21)22/h5-11,20H,3-4,12H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | SEVZHGOYIORRAR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |