C23H29N3O4 — CID 9223268
2-(4-benzoylpiperazin-1-yl)-N-(3,4-diethoxyphenyl)acetamide (PubChem CID 9223268) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-yl)-N-(3,4-diethoxyphenyl)acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-yl)-N-(3,4-diethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9223268 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-yl)-N-(3,4-diethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2CCN(C(=O)c3ccccc3)CC2)cc1OCC |
| InChI | InChI=1S/C23H29N3O4/c1-3-29-20-11-10-19(16-21(20)30-4-2)24-22(27)17-25-12-14-26(15-13-25)23(28)18-8-6-5-7-9-18/h5-11,16H,3-4,12-15,17H2,1-2H3,(H,24,27) |
| InChIKey | AWDDPKCEOALXRZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |