C22H29N3O3 — CID 120761601
2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(3,4-diethoxyphenyl)acetamide (PubChem CID 120761601) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(3,4-diethoxyphenyl)acetamide.
| Compound Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(3,4-diethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 120761601 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]-N-(3,4-diethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CN2C[C@@H](N)[C@H](c3ccccc3)C2)cc1OCC |
| InChI | InChI=1S/C22H29N3O3/c1-3-27-20-11-10-17(12-21(20)28-4-2)24-22(26)15-25-13-18(19(23)14-25)16-8-6-5-7-9-16/h5-12,18-19H,3-4,13-15,23H2,1-2H3,(H,24,26)/t18-,19+/m0/s1 |
| InChIKey | FIFBSMQVVIZUCI-RBUKOAKNSA-N |
| XLogP | 2.85 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |