C22H29N5O4 — CID 8546656
N-[(3,4-diethoxyphenyl)carbamoyl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide (PubChem CID 8546656) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)carbamoyl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-[(3,4-diethoxyphenyl)carbamoyl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 8546656 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)carbamoyl]-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide |
| SMILES | CCOc1ccc(NC(=O)NC(=O)CN2CCN(c3ccccn3)CC2)cc1OCC |
| InChI | InChI=1S/C22H29N5O4/c1-3-30-18-9-8-17(15-19(18)31-4-2)24-22(29)25-21(28)16-26-11-13-27(14-12-26)20-7-5-6-10-23-20/h5-10,15H,3-4,11-14,16H2,1-2H3,(H2,24,25,28,29) |
| InChIKey | UFNOKUFQMOIZIA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |