C23H28FN3O4 — CID 55944926
3,4-diethoxy-N-[2-(3-fluoro-4-pyrrolidin-1-ylanilino)-2-oxoethyl]benzamide (PubChem CID 55944926) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(3-fluoro-4-pyrrolidin-1-ylanilino)-2-oxoethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-(3-fluoro-4-pyrrolidin-1-ylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55944926 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 3,4-diethoxy-N-[2-(3-fluoro-4-pyrrolidin-1-ylanilino)-2-oxoethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)Nc2ccc(N3CCCC3)c(F)c2)cc1OCC |
| InChI | InChI=1S/C23H28FN3O4/c1-3-30-20-10-7-16(13-21(20)31-4-2)23(29)25-15-22(28)26-17-8-9-19(18(24)14-17)27-11-5-6-12-27/h7-10,13-14H,3-6,11-12,15H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | WZKRBPFWJUSDOH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|