C7H9F2NO2 — CID 144607728
(2Z,4E)-2,4-difluoro-3-nitrohepta-2,4-diene (PubChem CID 144607728) has the molecular formula C7H9F2NO2 and a molecular weight of 177.15 g/mol. Its IUPAC name is (2Z,4E)-2,4-difluoro-3-nitrohepta-2,4-diene.
| Compound Name | (2Z,4E)-2,4-difluoro-3-nitrohepta-2,4-diene |
|---|---|
| PubChem CID | 144607728 |
| Molecular Formula | C7H9F2NO2 |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2Z,4E)-2,4-difluoro-3-nitrohepta-2,4-diene |
| SMILES | CC/C=C(F)\C(=C(/C)F)[N+](=O)[O-] |
| InChI | InChI=1S/C7H9F2NO2/c1-3-4-6(9)7(5(2)8)10(11)12/h4H,3H2,1-2H3/b6-4+,7-5- |
| InChIKey | SYJVEXVTQDKUJJ-GUBXDBFYSA-N |
| XLogP | 2.73 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|