C9H15F3N2O2 — CID 89035618
1,1,1-trifluoro-N,2-dimethyl-N-[(E)-2-nitroprop-1-enyl]butan-2-amine (PubChem CID 89035618) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-N,2-dimethyl-N-[(E)-2-nitroprop-1-enyl]butan-2-amine.
| Compound Name | 1,1,1-trifluoro-N,2-dimethyl-N-[(E)-2-nitroprop-1-enyl]butan-2-amine |
|---|---|
| PubChem CID | 89035618 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 1,1,1-trifluoro-N,2-dimethyl-N-[(E)-2-nitroprop-1-enyl]butan-2-amine |
| SMILES | CCC(C)(N(C)/C=C(\C)[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O2/c1-5-8(3,9(10,11)12)13(4)6-7(2)14(15)16/h6H,5H2,1-4H3/b7-6+ |
| InChIKey | SUOMKWBSZJDOKT-VOTSOKGWSA-N |
| XLogP | 2.79 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|