C8H14N2O4 — CID 88832757
2,3,3-trimethyl-1,1-dinitropent-1-ene (PubChem CID 88832757) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2,3,3-trimethyl-1,1-dinitropent-1-ene.
| Compound Name | 2,3,3-trimethyl-1,1-dinitropent-1-ene |
|---|---|
| PubChem CID | 88832757 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2,3,3-trimethyl-1,1-dinitropent-1-ene |
| SMILES | CCC(C)(C)C(C)=C([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N2O4/c1-5-8(3,4)6(2)7(9(11)12)10(13)14/h5H2,1-4H3 |
| InChIKey | TXLZUGXTHPBYQF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|