C4H9N3 — CID 58774645
1-N'-(ethylideneamino)ethene-1,1-diamine (PubChem CID 58774645) has the molecular formula C4H9N3 and a molecular weight of 99.14 g/mol. Its IUPAC name is 1-N'-(ethylideneamino)ethene-1,1-diamine.
| Compound Name | 1-N'-(ethylideneamino)ethene-1,1-diamine |
|---|---|
| PubChem CID | 58774645 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | 1-N'-(ethylideneamino)ethene-1,1-diamine |
| SMILES | C=C(N)NN=CC |
| InChI | InChI=1S/C4H9N3/c1-3-6-7-4(2)5/h3,7H,2,5H2,1H3 |
| InChIKey | YEUYZADGGNOTEY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|