C3H10Cl2N2 — CID 141360869
prop-1-ene-1,1-diamine;dihydrochloride (PubChem CID 141360869) has the molecular formula C3H10Cl2N2 and a molecular weight of 145.03 g/mol. Its IUPAC name is prop-1-ene-1,1-diamine;dihydrochloride.
| Compound Name | prop-1-ene-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 141360869 |
| Molecular Formula | C3H10Cl2N2 |
| Molecular Weight | 145.03 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | prop-1-ene-1,1-diamine;dihydrochloride |
| SMILES | CC=C(N)N.Cl.Cl |
| InChI | InChI=1S/C3H8N2.2ClH/c1-2-3(4)5;;/h2H,4-5H2,1H3;2*1H |
| InChIKey | HXCFYRWZTUDDQV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.03 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |