C2H6N2O2S — CID 174754285
2,2-diaminoethenesulfinic acid (PubChem CID 174754285) has the molecular formula C2H6N2O2S and a molecular weight of 122.15 g/mol. Its IUPAC name is 2,2-diaminoethenesulfinic acid.
| Compound Name | 2,2-diaminoethenesulfinic acid |
|---|---|
| PubChem CID | 174754285 |
| Molecular Formula | C2H6N2O2S |
| Molecular Weight | 122.15 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | 2,2-diaminoethenesulfinic acid |
| SMILES | NC(N)=CS(=O)O |
| InChI | InChI=1S/C2H6N2O2S/c3-2(4)1-7(5)6/h1H,3-4H2,(H,5,6) |
| InChIKey | NXKTYWSKBALDFW-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.15 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|