molecular nitrogen;sulfurous acid

H4N2O6S2 — CID 175506795

IUPACmolecular nitrogen;sulfurous acid
SMILESN#N.O=S(O)O.O=S(O)O
InChIInChI=1S/N2.2H2O3S/c1-2;2*1-4(2)3/h;2*(H2,1,2,3)
InChIKeyCWAHLOLUXFFEIJ-UHFFFAOYSA-N
MW192.17 g/mol
LogP-0.61
Rot. Bonds

About molecular nitrogen;sulfurous acid

molecular nitrogen;sulfurous acid (PubChem CID 175506795) has the molecular formula H4N2O6S2 and a molecular weight of 192.17 g/mol. Its IUPAC name is molecular nitrogen;sulfurous acid.

Molecular Properties

Compound Namemolecular nitrogen;sulfurous acid
PubChem CID175506795
Molecular FormulaH4N2O6S2
Molecular Weight192.17 g/mol
Exact Mass191.95
IUPAC Namemolecular nitrogen;sulfurous acid
SMILESN#N.O=S(O)O.O=S(O)O
InChIInChI=1S/N2.2H2O3S/c1-2;2*1-4(2)3/h;2*(H2,1,2,3)
InChIKeyCWAHLOLUXFFEIJ-UHFFFAOYSA-N
XLogP-0.61
TPSA162.64 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 5-0.61
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze molecular nitrogen;sulfurous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular nitrogen;sulfurous acid?
The IUPAC name of molecular nitrogen;sulfurous acid (CID 175506795) is molecular nitrogen;sulfurous acid.
What is the SMILES notation for molecular nitrogen;sulfurous acid?
The canonical SMILES for molecular nitrogen;sulfurous acid is N#N.O=S(O)O.O=S(O)O.
What is the InChIKey of molecular nitrogen;sulfurous acid?
The InChIKey is CWAHLOLUXFFEIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/N2.2H2O3S/c1-2;2*1-4(2)3/h;2*(H2,1,2,3).
What are the key properties of molecular nitrogen;sulfurous acid?
molecular nitrogen;sulfurous acid has a molecular weight of 192.17 g/mol, XLogP of -0.61, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for molecular nitrogen;sulfurous acid is sourced from PubChem (CID 175506795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).