C2H5N2O2S- — CID 174754284
2,2-diaminoethenesulfinate (PubChem CID 174754284) has the molecular formula C2H5N2O2S- and a molecular weight of 121.14 g/mol. Its IUPAC name is 2,2-diaminoethenesulfinate.
| Compound Name | 2,2-diaminoethenesulfinate |
|---|---|
| PubChem CID | 174754284 |
| Molecular Formula | C2H5N2O2S- |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.01 |
| IUPAC Name | 2,2-diaminoethenesulfinate |
| SMILES | NC(N)=CS(=O)[O-] |
| InChI | InChI=1S/C2H6N2O2S/c3-2(4)1-7(5)6/h1H,3-4H2,(H,5,6)/p-1 |
| InChIKey | NXKTYWSKBALDFW-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|