C5H7LiO2S — CID 122229942
lithium (1E)-2-methylbuta-1,3-diene-1-sulfinate (PubChem CID 122229942) has the molecular formula C5H7LiO2S and a molecular weight of 138.12 g/mol. Its IUPAC name is lithium (1E)-2-methylbuta-1,3-diene-1-sulfinate.
| Compound Name | lithium (1E)-2-methylbuta-1,3-diene-1-sulfinate |
|---|---|
| PubChem CID | 122229942 |
| Molecular Formula | C5H7LiO2S |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | lithium (1E)-2-methylbuta-1,3-diene-1-sulfinate |
| SMILES | C=C/C(C)=C/S(=O)[O-].[Li+] |
| InChI | InChI=1S/C5H8O2S.Li/c1-3-5(2)4-8(6)7;/h3-4H,1H2,2H3,(H,6,7);/q;+1/p-1/b5-4+; |
| InChIKey | HAHDSGQIBIXKBW-FXRZFVDSSA-M |
| XLogP | -2.04 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|