About ethenesulfinate;prop-2-enoic acid
ethenesulfinate;prop-2-enoic acid (PubChem CID 174788778) has the molecular formula C5H7O4S-
and a molecular weight of 163.17 g/mol. Its IUPAC name is ethenesulfinate;prop-2-enoic acid.
Molecular Properties
| Compound Name | ethenesulfinate;prop-2-enoic acid |
| PubChem CID | 174788778 |
| Molecular Formula | C5H7O4S- |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | ethenesulfinate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=CS(=O)[O-] |
| InChI | InChI=1S/C3H4O2.C2H4O2S/c1-2-3(4)5;1-2-5(3)4/h2H,1H2,(H,4,5);2H,1H2,(H,3,4)/p-1 |
| InChIKey | CVQBHLGIXMJXBY-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ethenesulfinate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenesulfinate;prop-2-enoic acid?
The IUPAC name of ethenesulfinate;prop-2-enoic acid (CID 174788778) is ethenesulfinate;prop-2-enoic acid.
What is the SMILES notation for ethenesulfinate;prop-2-enoic acid?
The canonical SMILES for ethenesulfinate;prop-2-enoic acid is C=CC(=O)O.C=CS(=O)[O-].
What is the InChIKey of ethenesulfinate;prop-2-enoic acid?
The InChIKey is CVQBHLGIXMJXBY-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4O2.C2H4O2S/c1-2-3(4)5;1-2-5(3)4/h2H,1H2,(H,4,5);2H,1H2,(H,3,4)/p-1.
What are the key properties of ethenesulfinate;prop-2-enoic acid?
ethenesulfinate;prop-2-enoic acid has a molecular weight of 163.17 g/mol, XLogP of 0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenesulfinate;prop-2-enoic acid is sourced from PubChem (CID 174788778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).