About ethenesulfinate;methane
ethenesulfinate;methane (PubChem CID 174592359) has the molecular formula C3H7O2S-
and a molecular weight of 107.15 g/mol. Its IUPAC name is ethenesulfinate;methane.
Molecular Properties
| Compound Name | ethenesulfinate;methane |
| PubChem CID | 174592359 |
| Molecular Formula | C3H7O2S- |
| Molecular Weight | 107.15 g/mol |
| Exact Mass | 107.02 |
| IUPAC Name | ethenesulfinate;methane |
| SMILES | C.C=CS(=O)[O-] |
| InChI | InChI=1S/C2H4O2S.CH4/c1-2-5(3)4;/h2H,1H2,(H,3,4);1H4/p-1 |
| InChIKey | AIELPNVTFKHBJY-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ethenesulfinate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenesulfinate;methane?
The IUPAC name of ethenesulfinate;methane (CID 174592359) is ethenesulfinate;methane.
What is the SMILES notation for ethenesulfinate;methane?
The canonical SMILES for ethenesulfinate;methane is C.C=CS(=O)[O-].
What is the InChIKey of ethenesulfinate;methane?
The InChIKey is AIELPNVTFKHBJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2S.CH4/c1-2-5(3)4;/h2H,1H2,(H,3,4);1H4/p-1.
What are the key properties of ethenesulfinate;methane?
ethenesulfinate;methane has a molecular weight of 107.15 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenesulfinate;methane is sourced from PubChem (CID 174592359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).