About CID 88628598
CID 88628598 (PubChem CID 88628598) has the molecular formula C4H6NaOS
and a molecular weight of 125.15 g/mol.
Molecular Properties
| Compound Name | CID 88628598 |
| PubChem CID | 88628598 |
| Molecular Formula | C4H6NaOS |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.00 |
| IUPAC Name | — |
| SMILES | C=CS(=O)C=C.[Na] |
| InChI | InChI=1S/C4H6OS.Na/c1-3-6(5)4-2;/h3-4H,1-2H2; |
| InChIKey | ATQFXXUZGYLKSF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 88628598 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88628598?
The IUPAC name of CID 88628598 (CID 88628598) is not available.
What is the SMILES notation for CID 88628598?
The canonical SMILES for CID 88628598 is C=CS(=O)C=C.[Na].
What is the InChIKey of CID 88628598?
The InChIKey is ATQFXXUZGYLKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6OS.Na/c1-3-6(5)4-2;/h3-4H,1-2H2;.
What are the key properties of CID 88628598?
CID 88628598 has a molecular weight of 125.15 g/mol, XLogP of 0.64, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88628598 is sourced from PubChem (CID 88628598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).