C7H12O2S2 — CID 139841414
1,3-bis(ethenylsulfinyl)propane (PubChem CID 139841414) has the molecular formula C7H12O2S2 and a molecular weight of 192.30 g/mol. Its IUPAC name is 1,3-bis(ethenylsulfinyl)propane.
| Compound Name | 1,3-bis(ethenylsulfinyl)propane |
|---|---|
| PubChem CID | 139841414 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 1,3-bis(ethenylsulfinyl)propane |
| SMILES | C=CS(=O)CCCS(=O)C=C |
| InChI | InChI=1S/C7H12O2S2/c1-3-10(8)6-5-7-11(9)4-2/h3-4H,1-2,5-7H2 |
| InChIKey | PTGYYAXJUWXCPM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |