C16H24OS — CID 134888091
3-methylidene-6-(octylsulfinylmethylidene)cyclohexa-1,4-diene (PubChem CID 134888091) has the molecular formula C16H24OS and a molecular weight of 264.43 g/mol. Its IUPAC name is 3-methylidene-6-(octylsulfinylmethylidene)cyclohexa-1,4-diene.
| Compound Name | 3-methylidene-6-(octylsulfinylmethylidene)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 134888091 |
| Molecular Formula | C16H24OS |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-methylidene-6-(octylsulfinylmethylidene)cyclohexa-1,4-diene |
| SMILES | C=c1ccc(=CS(=O)CCCCCCCC)cc1 |
| InChI | InChI=1S/C16H24OS/c1-3-4-5-6-7-8-13-18(17)14-16-11-9-15(2)10-12-16/h9-12,14H,2-8,13H2,1H3 |
| InChIKey | VOKQOMGWJCZAFO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|