About 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide
3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide (PubChem CID 88846082) has the molecular formula C6H10O4S2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide.
Molecular Properties
| Compound Name | 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide |
| PubChem CID | 88846082 |
| Molecular Formula | C6H10O4S2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide |
| SMILES | C=CCS(=O)CC=C.O=S(=O)=O |
| InChI | InChI=1S/C6H10OS.O3S/c1-3-5-8(7)6-4-2;1-4(2)3/h3-4H,1-2,5-6H2; |
| InChIKey | YBNJTEZGUBHGKU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide?
The IUPAC name of 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide (CID 88846082) is 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide.
What is the SMILES notation for 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide?
The canonical SMILES for 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide is C=CCS(=O)CC=C.O=S(=O)=O.
What is the InChIKey of 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide?
The InChIKey is YBNJTEZGUBHGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS.O3S/c1-3-5-8(7)6-4-2;1-4(2)3/h3-4H,1-2,5-6H2;.
What are the key properties of 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide?
3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide has a molecular weight of 210.28 g/mol, XLogP of 0.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enylsulfinylprop-1-ene;sulfur trioxide is sourced from PubChem (CID 88846082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).