C9H15FO2S2 — CID 4584125
2-fluoro-1,3-bis(prop-2-enylsulfinyl)propane (PubChem CID 4584125) has the molecular formula C9H15FO2S2 and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-fluoro-1,3-bis(prop-2-enylsulfinyl)propane.
| Compound Name | 2-fluoro-1,3-bis(prop-2-enylsulfinyl)propane |
|---|---|
| PubChem CID | 4584125 |
| Molecular Formula | C9H15FO2S2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-fluoro-1,3-bis(prop-2-enylsulfinyl)propane |
| SMILES | C=CCS(=O)CC(F)CS(=O)CC=C |
| InChI | InChI=1S/C9H15FO2S2/c1-3-5-13(11)7-9(10)8-14(12)6-4-2/h3-4,9H,1-2,5-8H2 |
| InChIKey | CQBBJUWQFHDVGJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|