C12H14FNO3S — CID 175870822
(2R)-2-(4-fluoroanilino)-3-prop-2-enylsulfinylpropanoic acid (PubChem CID 175870822) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is (2R)-2-(4-fluoroanilino)-3-prop-2-enylsulfinylpropanoic acid.
| Compound Name | (2R)-2-(4-fluoroanilino)-3-prop-2-enylsulfinylpropanoic acid |
|---|---|
| PubChem CID | 175870822 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (2R)-2-(4-fluoroanilino)-3-prop-2-enylsulfinylpropanoic acid |
| SMILES | C=CCS(=O)C[C@H](Nc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C12H14FNO3S/c1-2-7-18(17)8-11(12(15)16)14-10-5-3-9(13)4-6-10/h2-6,11,14H,1,7-8H2,(H,15,16)/t11-,18?/m0/s1 |
| InChIKey | QZSOHPGOBFMERT-FAQQKDIKSA-N |
| XLogP | 1.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|