C9H15NO3S — CID 118585099
8-ethenylsulfinyl-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 118585099) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 8-ethenylsulfinyl-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-ethenylsulfinyl-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 118585099 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 8-ethenylsulfinyl-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | C=CS(=O)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H15NO3S/c1-2-14(11)10-5-3-9(4-6-10)12-7-8-13-9/h2H,1,3-8H2 |
| InChIKey | XKAOPHQWLNZDPV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |