C12H19NO3 — CID 167274139
8-[(3E)-4-methoxybuta-1,3-dien-2-yl]-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 167274139) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 8-[(3E)-4-methoxybuta-1,3-dien-2-yl]-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-[(3E)-4-methoxybuta-1,3-dien-2-yl]-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 167274139 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 8-[(3E)-4-methoxybuta-1,3-dien-2-yl]-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | C=C(/C=C/OC)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H19NO3/c1-11(3-8-14-2)13-6-4-12(5-7-13)15-9-10-16-12/h3,8H,1,4-7,9-10H2,2H3/b8-3+ |
| InChIKey | OJLYBRILFHFGQS-FPYGCLRLSA-N |
| XLogP | 1.50 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|