C8H12NNaO2S2 — CID 87287028
sodium 1,4-dioxa-8-azaspiro[4.5]decane-8-carbodithioate (PubChem CID 87287028) has the molecular formula C8H12NNaO2S2 and a molecular weight of 241.31 g/mol. Its IUPAC name is sodium 1,4-dioxa-8-azaspiro[4.5]decane-8-carbodithioate.
| Compound Name | sodium 1,4-dioxa-8-azaspiro[4.5]decane-8-carbodithioate |
|---|---|
| PubChem CID | 87287028 |
| Molecular Formula | C8H12NNaO2S2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | sodium 1,4-dioxa-8-azaspiro[4.5]decane-8-carbodithioate |
| SMILES | S=C([S-])N1CCC2(CC1)OCCO2.[Na+] |
| InChI | InChI=1S/C8H13NO2S2.Na/c12-7(13)9-3-1-8(2-4-9)10-5-6-11-8;/h1-6H2,(H,12,13);/q;+1/p-1 |
| InChIKey | WAIJMCROPXFUKG-UHFFFAOYSA-M |
| XLogP | -2.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|