C9H14INO3 — CID 54422172
1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-iodoethanone (PubChem CID 54422172) has the molecular formula C9H14INO3 and a molecular weight of 311.12 g/mol. Its IUPAC name is 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-iodoethanone.
| Compound Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-iodoethanone |
|---|---|
| PubChem CID | 54422172 |
| Molecular Formula | C9H14INO3 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-iodoethanone |
| SMILES | O=C(CI)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H14INO3/c10-7-8(12)11-3-1-9(2-4-11)13-5-6-14-9/h1-7H2 |
| InChIKey | WBOXGKDVKLAZBS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|