C12H20BrNO3 — CID 107910404
5-bromo-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pentan-1-one (PubChem CID 107910404) has the molecular formula C12H20BrNO3 and a molecular weight of 306.20 g/mol. Its IUPAC name is 5-bromo-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pentan-1-one.
| Compound Name | 5-bromo-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pentan-1-one |
|---|---|
| PubChem CID | 107910404 |
| Molecular Formula | C12H20BrNO3 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 5-bromo-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pentan-1-one |
| SMILES | O=C(CCCCBr)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H20BrNO3/c13-6-2-1-3-11(15)14-7-4-12(5-8-14)16-9-10-17-12/h1-10H2 |
| InChIKey | MAMORZVUTGZELO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|