C14H25NO3 — CID 115775416
1-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)heptan-1-one (PubChem CID 115775416) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)heptan-1-one.
| Compound Name | 1-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)heptan-1-one |
|---|---|
| PubChem CID | 115775416 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 1-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C14H25NO3/c1-2-3-4-5-7-13(16)15-9-6-8-14(12-15)17-10-11-18-14/h2-12H2,1H3 |
| InChIKey | JCPFXCVLCLIMTL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|