C16H29NO3 — CID 122136542
1-(1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)octan-1-one (PubChem CID 122136542) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-(1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)octan-1-one.
| Compound Name | 1-(1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)octan-1-one |
|---|---|
| PubChem CID | 122136542 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-(1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCC2(CC1)OCCCO2 |
| InChI | InChI=1S/C16H29NO3/c1-2-3-4-5-6-8-15(18)17-11-9-16(10-12-17)19-13-7-14-20-16/h2-14H2,1H3 |
| InChIKey | WPRAEJXTLXOATR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|