C11H15NO6 — CID 121408514
(Z)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-hydroxy-4-oxobut-2-enoic acid (PubChem CID 121408514) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is (Z)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-hydroxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-hydroxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 121408514 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (Z)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-hydroxy-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C(O)=C/C(=O)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H15NO6/c13-8(10(15)16)7-9(14)12-3-1-11(2-4-12)17-5-6-18-11/h7,13H,1-6H2,(H,15,16)/b8-7- |
| InChIKey | FABLPTCNHWPIPY-FPLPWBNLSA-N |
| XLogP | -0.12 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|