C12H21NO2 — CID 114448872
8-(3-methylbut-3-enyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 114448872) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 8-(3-methylbut-3-enyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(3-methylbut-3-enyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 114448872 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 8-(3-methylbut-3-enyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | C=C(C)CCN1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H21NO2/c1-11(2)3-6-13-7-4-12(5-8-13)14-9-10-15-12/h1,3-10H2,2H3 |
| InChIKey | RZNGDGJTOSJNOC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|