C13H26N2O2 — CID 129354044
6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)hexan-1-amine (PubChem CID 129354044) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)hexan-1-amine.
| Compound Name | 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)hexan-1-amine |
|---|---|
| PubChem CID | 129354044 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)hexan-1-amine |
| SMILES | NCCCCCCN1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H26N2O2/c14-7-3-1-2-4-8-15-9-5-13(6-10-15)16-11-12-17-13/h1-12,14H2 |
| InChIKey | PVEUFUWPPNLHRJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|