C14H21NO6 — CID 142800259
(E)-4-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propoxy]-4-oxobut-2-enoic acid (PubChem CID 142800259) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is (E)-4-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 142800259 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (E)-4-[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propoxy]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)OCCCN1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H21NO6/c16-12(17)2-3-13(18)19-9-1-6-15-7-4-14(5-8-15)20-10-11-21-14/h2-3H,1,4-11H2,(H,16,17)/b3-2+ |
| InChIKey | NKSUPKTVUNREOQ-NSCUHMNNSA-N |
| XLogP | 0.40 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|