About chlorosulfinyloxyethene
chlorosulfinyloxyethene (PubChem CID 170554483) has the molecular formula C2H3ClO2S
and a molecular weight of 126.56 g/mol. Its IUPAC name is chlorosulfinyloxyethene.
Molecular Properties
| Compound Name | chlorosulfinyloxyethene |
| PubChem CID | 170554483 |
| Molecular Formula | C2H3ClO2S |
| Molecular Weight | 126.56 g/mol |
| Exact Mass | 125.95 |
| IUPAC Name | chlorosulfinyloxyethene |
| SMILES | C=COS(=O)Cl |
| InChI | InChI=1S/C2H3ClO2S/c1-2-5-6(3)4/h2H,1H2 |
| InChIKey | KPCXKWQKINBTFS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.56 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze chlorosulfinyloxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosulfinyloxyethene?
The IUPAC name of chlorosulfinyloxyethene (CID 170554483) is chlorosulfinyloxyethene.
What is the SMILES notation for chlorosulfinyloxyethene?
The canonical SMILES for chlorosulfinyloxyethene is C=COS(=O)Cl.
What is the InChIKey of chlorosulfinyloxyethene?
The InChIKey is KPCXKWQKINBTFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3ClO2S/c1-2-5-6(3)4/h2H,1H2.
What are the key properties of chlorosulfinyloxyethene?
chlorosulfinyloxyethene has a molecular weight of 126.56 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosulfinyloxyethene is sourced from PubChem (CID 170554483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).