C12H14O2S — CID 85299579
1-methyl-4-(2-methylbuta-1,3-dienylsulfonyl)benzene (PubChem CID 85299579) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-methyl-4-(2-methylbuta-1,3-dienylsulfonyl)benzene.
| Compound Name | 1-methyl-4-(2-methylbuta-1,3-dienylsulfonyl)benzene |
|---|---|
| PubChem CID | 85299579 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-methyl-4-(2-methylbuta-1,3-dienylsulfonyl)benzene |
| SMILES | C=CC(C)=CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H14O2S/c1-4-10(2)9-15(13,14)12-7-5-11(3)6-8-12/h4-9H,1H2,2-3H3 |
| InChIKey | DQVOGVUUGUJMMD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|