C11H14O3S — CID 14296310
2-methyl-3-(4-methylphenyl)sulfonylprop-2-en-1-ol (PubChem CID 14296310) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-methyl-3-(4-methylphenyl)sulfonylprop-2-en-1-ol.
| Compound Name | 2-methyl-3-(4-methylphenyl)sulfonylprop-2-en-1-ol |
|---|---|
| PubChem CID | 14296310 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-methyl-3-(4-methylphenyl)sulfonylprop-2-en-1-ol |
| SMILES | CC(=CS(=O)(=O)c1ccc(C)cc1)CO |
| InChI | InChI=1S/C11H14O3S/c1-9-3-5-11(6-4-9)15(13,14)8-10(2)7-12/h3-6,8,12H,7H2,1-2H3 |
| InChIKey | YBNGXONFPQKUFG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |