C3H9N2Na — CID 174521873
sodium;hydride;prop-1-ene-1,1-diamine (PubChem CID 174521873) has the molecular formula C3H9N2Na and a molecular weight of 96.11 g/mol. Its IUPAC name is sodium;hydride;prop-1-ene-1,1-diamine.
| Compound Name | sodium;hydride;prop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 174521873 |
| Molecular Formula | C3H9N2Na |
| Molecular Weight | 96.11 g/mol |
| Exact Mass | 96.07 |
| IUPAC Name | sodium;hydride;prop-1-ene-1,1-diamine |
| SMILES | CC=C(N)N.[H-].[Na+] |
| InChI | InChI=1S/C3H8N2.Na.H/c1-2-3(4)5;;/h2H,4-5H2,1H3;;/q;+1;-1 |
| InChIKey | KRIPNEVXBKIPGW-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.11 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |