About lithium;hydride;2-methylbut-2-ene
lithium;hydride;2-methylbut-2-ene (PubChem CID 174648153) has the molecular formula C5H11Li
and a molecular weight of 78.08 g/mol. Its IUPAC name is lithium;hydride;2-methylbut-2-ene.
Molecular Properties
| Compound Name | lithium;hydride;2-methylbut-2-ene |
| PubChem CID | 174648153 |
| Molecular Formula | C5H11Li |
| Molecular Weight | 78.08 g/mol |
| Exact Mass | 78.10 |
| IUPAC Name | lithium;hydride;2-methylbut-2-ene |
| SMILES | CC=C(C)C.[H-].[Li+] |
| InChI | InChI=1S/C5H10.Li.H/c1-4-5(2)3;;/h4H,1-3H3;;/q;+1;-1 |
| InChIKey | BOCCERYPBXYLRU-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.08 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;2-methylbut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;2-methylbut-2-ene?
The IUPAC name of lithium;hydride;2-methylbut-2-ene (CID 174648153) is lithium;hydride;2-methylbut-2-ene.
What is the SMILES notation for lithium;hydride;2-methylbut-2-ene?
The canonical SMILES for lithium;hydride;2-methylbut-2-ene is CC=C(C)C.[H-].[Li+].
What is the InChIKey of lithium;hydride;2-methylbut-2-ene?
The InChIKey is BOCCERYPBXYLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10.Li.H/c1-4-5(2)3;;/h4H,1-3H3;;/q;+1;-1.
What are the key properties of lithium;hydride;2-methylbut-2-ene?
lithium;hydride;2-methylbut-2-ene has a molecular weight of 78.08 g/mol, XLogP of -0.91, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;2-methylbut-2-ene is sourced from PubChem (CID 174648153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).