About 2-methylbut-2-ene;silane;hydrate
2-methylbut-2-ene;silane;hydrate (PubChem CID 174815005) has the molecular formula C5H16OSi
and a molecular weight of 120.27 g/mol. Its IUPAC name is 2-methylbut-2-ene;silane;hydrate.
Molecular Properties
| Compound Name | 2-methylbut-2-ene;silane;hydrate |
| PubChem CID | 174815005 |
| Molecular Formula | C5H16OSi |
| Molecular Weight | 120.27 g/mol |
| Exact Mass | 120.10 |
| IUPAC Name | 2-methylbut-2-ene;silane;hydrate |
| SMILES | CC=C(C)C.O.[SiH4] |
| InChI | InChI=1S/C5H10.H2O.H4Si/c1-4-5(2)3;;/h4H,1-3H3;1H2;1H4 |
| InChIKey | SXBRQUIUINBSBC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-ene;silane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-ene;silane;hydrate?
The IUPAC name of 2-methylbut-2-ene;silane;hydrate (CID 174815005) is 2-methylbut-2-ene;silane;hydrate.
What is the SMILES notation for 2-methylbut-2-ene;silane;hydrate?
The canonical SMILES for 2-methylbut-2-ene;silane;hydrate is CC=C(C)C.O.[SiH4].
What is the InChIKey of 2-methylbut-2-ene;silane;hydrate?
The InChIKey is SXBRQUIUINBSBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10.H2O.H4Si/c1-4-5(2)3;;/h4H,1-3H3;1H2;1H4.
What are the key properties of 2-methylbut-2-ene;silane;hydrate?
2-methylbut-2-ene;silane;hydrate has a molecular weight of 120.27 g/mol, XLogP of -0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-ene;silane;hydrate is sourced from PubChem (CID 174815005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).