About guanidine;methylsulfinylmethane
guanidine;methylsulfinylmethane (PubChem CID 155669575) has the molecular formula C3H11N3OS
and a molecular weight of 137.21 g/mol. Its IUPAC name is guanidine;methylsulfinylmethane.
Molecular Properties
| Compound Name | guanidine;methylsulfinylmethane |
| PubChem CID | 155669575 |
| Molecular Formula | C3H11N3OS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | guanidine;methylsulfinylmethane |
| SMILES | CS(C)=O.[H]N=C(N)N |
| InChI | InChI=1S/C2H6OS.CH5N3/c1-4(2)3;2-1(3)4/h1-2H3;(H5,2,3,4) |
| InChIKey | SKJVPPIXGGPQPP-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze guanidine;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;methylsulfinylmethane?
The IUPAC name of guanidine;methylsulfinylmethane (CID 155669575) is guanidine;methylsulfinylmethane.
What is the SMILES notation for guanidine;methylsulfinylmethane?
The canonical SMILES for guanidine;methylsulfinylmethane is CS(C)=O.[H]N=C(N)N.
What is the InChIKey of guanidine;methylsulfinylmethane?
The InChIKey is SKJVPPIXGGPQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6OS.CH5N3/c1-4(2)3;2-1(3)4/h1-2H3;(H5,2,3,4).
What are the key properties of guanidine;methylsulfinylmethane?
guanidine;methylsulfinylmethane has a molecular weight of 137.21 g/mol, XLogP of -1.17, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;methylsulfinylmethane is sourced from PubChem (CID 155669575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).