About potassium methylsulfinylmethane
potassium methylsulfinylmethane (PubChem CID 22410893) has the molecular formula C2H6KOS+
and a molecular weight of 117.23 g/mol. Its IUPAC name is potassium methylsulfinylmethane.
Molecular Properties
| Compound Name | potassium methylsulfinylmethane |
| PubChem CID | 22410893 |
| Molecular Formula | C2H6KOS+ |
| Molecular Weight | 117.23 g/mol |
| Exact Mass | 116.98 |
| IUPAC Name | potassium methylsulfinylmethane |
| SMILES | CS(C)=O.[K+] |
| InChI | InChI=1S/C2H6OS.K/c1-4(2)3;/h1-2H3;/q;+1 |
| InChIKey | UVYSUFOUEYARRC-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.23 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium methylsulfinylmethane?
The IUPAC name of potassium methylsulfinylmethane (CID 22410893) is potassium methylsulfinylmethane.
What is the SMILES notation for potassium methylsulfinylmethane?
The canonical SMILES for potassium methylsulfinylmethane is CS(C)=O.[K+].
What is the InChIKey of potassium methylsulfinylmethane?
The InChIKey is UVYSUFOUEYARRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6OS.K/c1-4(2)3;/h1-2H3;/q;+1.
What are the key properties of potassium methylsulfinylmethane?
potassium methylsulfinylmethane has a molecular weight of 117.23 g/mol, XLogP of -3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium methylsulfinylmethane is sourced from PubChem (CID 22410893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).