About sodium;methylsulfinylmethane;hydroxide;hydrate
sodium;methylsulfinylmethane;hydroxide;hydrate (PubChem CID 131740685) has the molecular formula C2H9NaO3S
and a molecular weight of 136.15 g/mol. Its IUPAC name is sodium;methylsulfinylmethane;hydroxide;hydrate.
Molecular Properties
| Compound Name | sodium;methylsulfinylmethane;hydroxide;hydrate |
| PubChem CID | 131740685 |
| Molecular Formula | C2H9NaO3S |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.02 |
| IUPAC Name | sodium;methylsulfinylmethane;hydroxide;hydrate |
| SMILES | CS(C)=O.O.[Na+].[OH-] |
| InChI | InChI=1S/C2H6OS.Na.2H2O/c1-4(2)3;;;/h1-2H3;;2*1H2/q;+1;;/p-1 |
| InChIKey | DOQZUBDBHFLARE-UHFFFAOYSA-M |
| XLogP | -4.00 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;methylsulfinylmethane;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;methylsulfinylmethane;hydroxide;hydrate?
The IUPAC name of sodium;methylsulfinylmethane;hydroxide;hydrate (CID 131740685) is sodium;methylsulfinylmethane;hydroxide;hydrate.
What is the SMILES notation for sodium;methylsulfinylmethane;hydroxide;hydrate?
The canonical SMILES for sodium;methylsulfinylmethane;hydroxide;hydrate is CS(C)=O.O.[Na+].[OH-].
What is the InChIKey of sodium;methylsulfinylmethane;hydroxide;hydrate?
The InChIKey is DOQZUBDBHFLARE-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H6OS.Na.2H2O/c1-4(2)3;;;/h1-2H3;;2*1H2/q;+1;;/p-1.
What are the key properties of sodium;methylsulfinylmethane;hydroxide;hydrate?
sodium;methylsulfinylmethane;hydroxide;hydrate has a molecular weight of 136.15 g/mol, XLogP of -4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;methylsulfinylmethane;hydroxide;hydrate is sourced from PubChem (CID 131740685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).