sodium;hydride;methanesulfinoperoxoic acid

CH5NaO3S — CID 173264502

IUPACsodium;hydride;methanesulfinoperoxoic acid
SMILESCS(=O)OO.[H-].[Na+]
InChIInChI=1S/CH4O3S.Na.H/c1-5(3)4-2;;/h2H,1H3;;/q;+1;-1
InChIKeyAYMWRENTLMPNPW-UHFFFAOYSA-N
MW120.10 g/mol
LogP-3.11
Rot. Bonds1

About sodium;hydride;methanesulfinoperoxoic acid

sodium;hydride;methanesulfinoperoxoic acid (PubChem CID 173264502) has the molecular formula CH5NaO3S and a molecular weight of 120.10 g/mol. Its IUPAC name is sodium;hydride;methanesulfinoperoxoic acid.

Molecular Properties

Compound Namesodium;hydride;methanesulfinoperoxoic acid
PubChem CID173264502
Molecular FormulaCH5NaO3S
Molecular Weight120.10 g/mol
Exact Mass119.99
IUPAC Namesodium;hydride;methanesulfinoperoxoic acid
SMILESCS(=O)OO.[H-].[Na+]
InChIInChI=1S/CH4O3S.Na.H/c1-5(3)4-2;;/h2H,1H3;;/q;+1;-1
InChIKeyAYMWRENTLMPNPW-UHFFFAOYSA-N
XLogP-3.11
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms6
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500120.10
LogP ≤ 5-3.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze sodium;hydride;methanesulfinoperoxoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium;hydride;methanesulfinoperoxoic acid?
The IUPAC name of sodium;hydride;methanesulfinoperoxoic acid (CID 173264502) is sodium;hydride;methanesulfinoperoxoic acid.
What is the SMILES notation for sodium;hydride;methanesulfinoperoxoic acid?
The canonical SMILES for sodium;hydride;methanesulfinoperoxoic acid is CS(=O)OO.[H-].[Na+].
What is the InChIKey of sodium;hydride;methanesulfinoperoxoic acid?
The InChIKey is AYMWRENTLMPNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4O3S.Na.H/c1-5(3)4-2;;/h2H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;methanesulfinoperoxoic acid?
sodium;hydride;methanesulfinoperoxoic acid has a molecular weight of 120.10 g/mol, XLogP of -3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;methanesulfinoperoxoic acid is sourced from PubChem (CID 173264502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).